|
|
| | 2-Amino-4-(trifluoromethyl)thiazole-5-c& Basic information |
| | 2-Amino-4-(trifluoromethyl)thiazole-5-c& Chemical Properties |
| Melting point | 232-236 °C (dec.)(lit.) | | Boiling point | 368.9±42.0 °C(Predicted) | | density | 1.761±0.06 g/cm3(Predicted) | | pka | 2.46±0.36(Predicted) | | form | powder | | color | Yellow | | InChI | 1S/C5H3F3N2O2S/c6-5(7,8)2-1(3(11)12)13-4(9)10-2/h(H2,9,10)(H,11,12) | | InChIKey | NGMYYADEHCNLGO-UHFFFAOYSA-N | | SMILES | Nc1nc(c(s1)C(O)=O)C(F)(F)F |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Amino-4-(trifluoromethyl)thiazole-5-c& Usage And Synthesis |
| | 2-Amino-4-(trifluoromethyl)thiazole-5-c& Preparation Products And Raw materials |
|