| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | Desmethyl-formamido-pirimicarb Basic information |
| Product Name: | Desmethyl-formamido-pirimicarb | | Synonyms: | 2-[Formyl(methyl)amino]-5,6-dimethyl-4-pyrimidinyl dimethylcarbamate;Carbamic acid, dimethyl-, ester with N-(4-hydroxy-5,6-dimethyl-2-pyrimidinyl)-N-methylformamide;carbamicacid,dimethyl-,2-(formylmethylamino)-5,6-dimethyl-4-pyrimidinylester;Pyrimidin-4-ol, 2-formylmethylamino, 5,6-dimethyl, N,N-dimethylcarbamate;Desmethylformamide pirimicarb;Dimethylcarbamic acid 2-(formylmethylamino)-5,6-dimethyl-4-pyrimidinyl ester;Pirimicarb II;2-<(methylformyl)amino>-5,6-dimethylpyrimidin-4-yl dimethylcarbamate | | CAS: | 27218-04-8 | | MF: | C11H16N4O3 | | MW: | 252.27 | | EINECS: | | | Product Categories: | | | Mol File: | 27218-04-8.mol |  |
| | Desmethyl-formamido-pirimicarb Chemical Properties |
| Boiling point | 413.8±55.0 °C(Predicted) | | density | 1.229±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.52±0.10(Predicted) | | Major Application | agriculture
environmental | | InChI | 1S/C11H16N4O3/c1-7-8(2)12-10(15(5)6-16)13-9(7)18-11(17)14(3)4/h6H,1-5H3 | | InChIKey | GDEAMEURJBBCOQ-UHFFFAOYSA-N | | SMILES | CN(C)C(=O)Oc1nc(nc(C)c1C)N(C)C=O |
| Hazard Codes | T,N | | Risk Statements | 25-50/53 | | Safety Statements | 45-60-61 | | RIDADR | UN2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | Desmethyl-formamido-pirimicarb Usage And Synthesis |
| Uses | Desmethyl-formamido-pirimicarb may be used as an analytical reference standard for the determination of the analyte in food samples using modified quick, easy, cheap, effective, rugged, and safe (QuEChERS) extraction method followed by liquid chromatography-tandem mass spectrometry (LC-MS/MS).', 'Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| | Desmethyl-formamido-pirimicarb Preparation Products And Raw materials |
|