| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:cis-Octahydro-2H-benzimidazol-2-one CAS:1123-97-3 Remarks:1220850748
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:cis-Octahydro-2H-benzimidazol-2-one CAS:1123-97-3 Purity:99% Package:25G Remarks:366307-25G
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Cis-Octahydro-2H-Benzimidazol-2-One CAS:1123-97-3 Purity:>=99% Package:5g Remarks:S54010
|
|
| | CIS-OCTAHYDRO-2H-BENZIMIDAZOL-2-ONE Basic information |
| | CIS-OCTAHYDRO-2H-BENZIMIDAZOL-2-ONE Chemical Properties |
| Melting point | 149-152 °C(lit.) | | Boiling point | 218-220 °C/14 mmHg(lit.) | | density | 1.084±0.06 g/cm3(Predicted) | | pka | 14.16±0.20(Predicted) | | InChI | 1S/C7H12N2O/c10-7-8-5-3-1-2-4-6(5)9-7/h5-6H,1-4H2,(H2,8,9,10)/t5-,6+ | | InChIKey | RWIIUBCMPVZLBA-OLQVQODUSA-N | | SMILES | [H][C@@]12CCCC[C@]1([H])NC(=O)N2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | DE2110000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | CIS-OCTAHYDRO-2H-BENZIMIDAZOL-2-ONE Usage And Synthesis |
| Uses | cis-Octahydro-2H-benzimidazol-2-one may be used in the preparation of hemicyclohexyl-cucurbit[n]uril (hmcyCucn). |
| | CIS-OCTAHYDRO-2H-BENZIMIDAZOL-2-ONE Preparation Products And Raw materials |
|