|
|
| | Benzyl-d7 cyanide, 98 atom % D Basic information |
| | Benzyl-d7 cyanide, 98 atom % D Chemical Properties |
| Melting point | −24 °C(lit.) | | Boiling point | 233-234 °C(lit.) | | density | 1.076 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.521(lit.) | | Fp | 215 °F | | InChI | 1S/C8H7N/c9-7-6-8-4-2-1-3-5-8/h1-5H,6H2/i1D,2D,3D,4D,5D,6D2 | | InChIKey | SUSQOBVLVYHIEX-XZJKGWKKSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])C#N |
| Hazard Codes | T,T+ | | Risk Statements | 23/24/25-36/38-26-24-22 | | Safety Statements | 26-36/37/39-45-36/37-28 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 3 Dermal Acute Tox. 3 Oral |
| | Benzyl-d7 cyanide, 98 atom % D Usage And Synthesis |
| | Benzyl-d7 cyanide, 98 atom % D Preparation Products And Raw materials |
|