| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 4H-[1]-Benzopyrano[4 3-b]thiophene-2-ca& Basic information |
| | 4H-[1]-Benzopyrano[4 3-b]thiophene-2-ca& Chemical Properties |
| Melting point | 240-245 °C(lit.) | | density | 1.414±0.06 g/cm3(Predicted) | | pka | 12.15±0.20(Predicted) | | form | solid | | InChI | 1S/C12H10N2O2S/c13-14-12(15)10-5-7-6-16-9-4-2-1-3-8(9)11(7)17-10/h1-5H,6,13H2,(H,14,15) | | InChIKey | BYNAEHIZFMTJEU-UHFFFAOYSA-N | | SMILES | NNC(=O)c1cc2COc3ccccc3-c2s1 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 4H-[1]-Benzopyrano[4 3-b]thiophene-2-ca& Usage And Synthesis |
| Uses | 4H-[1]-Benzopyrano[4,3-b]thiophene-2-carboxylic acid hydrazide may be used in gel-separated glycoprotein staining methods. |
| | 4H-[1]-Benzopyrano[4 3-b]thiophene-2-ca& Preparation Products And Raw materials |
|