| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:4-Bromobenzoic-2,3,5,6-d4 acid
CAS:787624-24-2
Package:100mg/RMB 550;250mg/RMB 1080
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:4-BroMobenzoic-d4 Acid
CAS:787624-24-2
Remarks:CS-C-01653
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:4-Bromobenzoic-2,3,5,6-D4 acid
CAS:787624-24-2
Purity:95% Package:100mg;250mg Remarks:BD01371137
|
|
| | 4-BROMOBENZOIC-D4 ACID Basic information |
| Product Name: | 4-BROMOBENZOIC-D4 ACID | | Synonyms: | Benzoic-2,3,5,6-d4 acid, 4-bromo- (9CI;4-bromo(2H?)benzoic acid;4-bromobenzoic-2,3,5,6-d4 acid;4-bromo-2,3,5,6-tetradeuteriobenzoic acid;deuterated p-bromobenzoic acid | | CAS: | 787624-24-2 | | MF: | C7H5BrO2 | | MW: | 201.02 | | EINECS: | | | Product Categories: | | | Mol File: | 787624-24-2.mol |  |
| | 4-BROMOBENZOIC-D4 ACID Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C7H5BrO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10) | | InChIKey | TUXYZHVUPGXXQG-UHFFFAOYSA-N | | SMILES | C(C1C([H])=C([H])C(Br)=C([H])C=1[H])(=O)O |
| | 4-BROMOBENZOIC-D4 ACID Usage And Synthesis |
| Uses | Isotope labelled 4-Bromobenzoic Acid is used in the synthesis of natural based insecticides. Also used in the synthesis of anticancer compounds used in the treatment of diseases such as breast cancer. |
| | 4-BROMOBENZOIC-D4 ACID Preparation Products And Raw materials |
|