| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Bromobenzoic-d4 acid Basic information |
| Product Name: | 4-Bromobenzoic-d4 acid | | Synonyms: | Benzoic-2,3,5,6-d4 acid, 4-bromo- (9CI;4-bromo(2H?)benzoic acid;4-bromobenzoic-2,3,5,6-d4 acid;4-bromo-2,3,5,6-tetradeuteriobenzoic acid;deuterated p-bromobenzoic acid | | CAS: | 787624-24-2 | | MF: | C7H5BrO2 | | MW: | 201.02 | | EINECS: | | | Product Categories: | | | Mol File: | 787624-24-2.mol |  |
| | 4-Bromobenzoic-d4 acid Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C7H5BrO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10) | | InChIKey | TUXYZHVUPGXXQG-UHFFFAOYSA-N | | SMILES | C(C1C([H])=C([H])C(Br)=C([H])C=1[H])(=O)O |
| | 4-Bromobenzoic-d4 acid Usage And Synthesis |
| Uses | Isotope labelled 4-Bromobenzoic Acid is used in the synthesis of natural based insecticides. Also used in the synthesis of anticancer compounds used in the treatment of diseases such as breast cancer. |
| | 4-Bromobenzoic-d4 acid Preparation Products And Raw materials |
|