|
|
| | 3,4-Furandiol, tetrahydro- Basic information | | Uses |
| | 3,4-Furandiol, tetrahydro- Chemical Properties |
| Melting point | 30-40 °C | | Boiling point | 153-156 °C(Press: 3-4 Torr) | | density | 1.411±0.06 g/cm3(Predicted) | | pka | 13.66±0.40(Predicted) | | InChI | InChI=1S/C4H8O3/c5-3-1-7-2-4(3)6/h3-6H,1-2H2 | | InChIKey | SSYDTHANSGMJTP-UHFFFAOYSA-N | | SMILES | O1CC(O)C(O)C1 |
| | 3,4-Furandiol, tetrahydro- Usage And Synthesis |
| Uses | 3,4-Dihydroxytetrahydrofuran is a furan compound used in organic synthesis. |
| | 3,4-Furandiol, tetrahydro- Preparation Products And Raw materials |
|