| Company Name: |
Jinan Kewei Biotechnology Co., LTD Gold
|
| Tel: |
15315592897 |
| Email: |
xmxingbjlg@163.com |
| Products Intro: |
Product Name:Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl]- CAS:87657-77-0 Purity:96% Package:100mg
|
|
| | Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl]- Basic information |
| Product Name: | Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl]- | | Synonyms: | Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-;1-(4-hydroxy-3-methoxyphenyl)-7-phenyl-3-heptanol;Oxyphyllacinol;Oxyphyllacinol Benzenepentanol;4-(3-Hydroxy-7-phenylheptyl)-2-methoxyphenol;Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-Oxyphyllacinol;Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl] | | CAS: | 87657-77-0 | | MF: | C20H26O3 | | MW: | 314.43 | | EINECS: | | | Product Categories: | | | Mol File: | 87657-77-0.mol | ![Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl]- Structure](CAS/20211123/GIF/87657-77-0.gif) |
| | Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl]- Chemical Properties |
| Boiling point | 494.6±45.0 °C(Predicted) | | density | 1.100±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | TBD:0.0(Max Conc. mg/mL);0.0(Max Conc. mM) | | form | Solid | | pka | 10.15±0.20(Predicted) | | color | White to off-white | | InChI | InChI=1S/C20H26O3/c1-23-20-15-17(12-14-19(20)22)11-13-18(21)10-6-5-9-16-7-3-2-4-8-16/h2-4,7-8,12,14-15,18,21-22H,5-6,9-11,13H2,1H3 | | InChIKey | DHUCMVAZNHOIPY-UHFFFAOYSA-N | | SMILES | C(C1C=CC(O)=C(OC)C=1)CC(O)CCCCC1C=CC=CC=1 |
| | Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl]- Usage And Synthesis |
| Uses | Oxyphyllacinol is a natural product that can be derived from the fruit of Alpinia oxyphylla[1]. | | References | [1] Hui LY, et, al. Nine Representative Phytochemicals Occurring in Leaves and Rhizomes of Alpinia oxyphylla Different to Those of Fruits Determined Using LC-MS/MS. 2015 Feb 20;27(5):1837-42. |
| | Benzenepentanol, α-[2-(4-hydroxy-3-methoxyphenyl)ethyl]- Preparation Products And Raw materials |
|