|
|
| | (1R)-(+)-TRANS-ISOLIMONENE Basic information |
| Product Name: | (1R)-(+)-TRANS-ISOLIMONENE | | Synonyms: | (3R,6R)-3-ISOPROPENYL-6-METHYLCYCLOHEXENE;ISOLIMONENE, 1R-TRANS;(+)-P-MENTHA-2,8-DIENE;(1R)-(+)-TRANS-ISOLIMONENE;1R-TRANS ISOLIMONENE;(+)-(1R,4R)-trans-Isolimonene;(+)-3R-trans-Isolimonene;(+)-trans-Isolimonene | | CAS: | 5113-87-1 | | MF: | C10H16 | | MW: | 136.23 | | EINECS: | 225-843-3 | | Product Categories: | | | Mol File: | 5113-87-1.mol |  |
| | (1R)-(+)-TRANS-ISOLIMONENE Chemical Properties |
| Boiling point | 165-166 °C (lit.) | | density | 0.83 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.47(lit.) | | Fp | 39 °C | | Optical Rotation | [α]20/D +212±5°, c = 10% in ethanol | | BRN | 2073245 | | InChI | 1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,9-10H,1,5,7H2,2-3H3/t9-,10-/m0/s1 | | InChIKey | TWCNAXRPQBLSNO-UWVGGRQHSA-N | | SMILES | C[C@@H]1CC[C@H](C=C1)C(C)=C |
| Hazard Codes | Xn,N | | Risk Statements | 10-51/53-22 | | Safety Statements | 61 | | RIDADR | UN 1169 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Flam. Liq. 3 |
| | (1R)-(+)-TRANS-ISOLIMONENE Usage And Synthesis |
| Uses | (+)-trans-Isolimonene is a natural monoterpene isolated from essential oil[1]. | | Definition | ChEBI: Isolimonene is a monoterpene that is cyclohex-1-ene substituted by a methyl group at position 3 and a prop-1-en-2-yl group at position 6 respectively. It has a role as a plant metabolite and a human metabolite. It is a cycloalkene and a p-menthadiene. | | References | [1] Naigre, R., et al. Comparison of Antimicrobial Properties of Monoterpenes and their Carbonylated Products. Planta Medica, 62(03), 275–277. |
| | (1R)-(+)-TRANS-ISOLIMONENE Preparation Products And Raw materials |
|