| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:(S)-(-)-1,2-PROPANEDIOL DI-P-TOSYLATE CAS:60434-71-1
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:S-(-)-1,2-Propanediol di-p-tosylate CAS:60434-71-1 Purity:99% Package:1g,5g
|
|
| | (S)-(-)-1,2-PROPANEDIOL DI-P-TOSYLATE Basic information |
| | (S)-(-)-1,2-PROPANEDIOL DI-P-TOSYLATE Chemical Properties |
| Melting point | 68-70 °C(lit.) | | Boiling point | 481.14°C (rough estimate) | | alpha | [α]D20 -15~-19° (c=2, C2H5OH) | | density | 1.3519 (rough estimate) | | refractive index | 1.6950 (estimate) | | form | solid | | Optical Rotation | [α]20/D -20°, c =1 in chloroform | | InChI | 1S/C17H20O6S2/c1-13-4-8-16(9-5-13)24(18,19)22-12-15(3)23-25(20,21)17-10-6-14(2)7-11-17/h4-11,15H,12H2,1-3H3/t15-/m0/s1 | | InChIKey | QSFWYZTZYVIPGD-HNNXBMFYSA-N | | SMILES | C[C@@H](COS(=O)(=O)c1ccc(C)cc1)OS(=O)(=O)c2ccc(C)cc2 | | CAS DataBase Reference | 60434-71-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29309099 | | Storage Class | 11 - Combustible Solids |
| | (S)-(-)-1,2-PROPANEDIOL DI-P-TOSYLATE Usage And Synthesis |
| Chemical Properties | white crystals |
| | (S)-(-)-1,2-PROPANEDIOL DI-P-TOSYLATE Preparation Products And Raw materials |
|