| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
6-Nitro-3,4-dihydro-2H-1,4-benzoxazine manufacturers
|
| | 6-Nitro-3,4-dihydro-2H-1,4-benzoxazine Basic information |
| Product Name: | 6-Nitro-3,4-dihydro-2H-1,4-benzoxazine | | Synonyms: | 6-NITRO-3,4-DIHYDRO-2H-BENZO[1,4]OXAZINE HYDROCHLORIDE;3,4-Dihydro-6-nitro-2H-benzo[B][1,4]-oxazine;6-nitro-3,4-dihydro-2H-benzo[b][1,4]oxazine hydrochloride;6-Nitro-3,4-dihydro-2H-benzo[1,4]oxazine 1HCl salt;6-nitro-1,4-benzoxazine;2H-1,4-Benzoxazine, 3,4-dihydro-6-nitro-;6-Nitro-3,4-dihydro-2H-1,4-benzoxazine,97%;6-NITRO-3,4-DI HYDRO-2H-BENZOXAZINE | | CAS: | 28226-22-4 | | MF: | C8H8N2O3 | | MW: | 180.16 | | EINECS: | | | Product Categories: | | | Mol File: | 28226-22-4.mol |  |
| | 6-Nitro-3,4-dihydro-2H-1,4-benzoxazine Chemical Properties |
| Melting point | 117-119° | | Boiling point | 337.1±42.0 °C(Predicted) | | density | 1.332±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 2.67±0.20(Predicted) | | Appearance | Orange to red Solid | | InChI | 1S/C8H8N2O3/c11-10(12)6-1-2-8-7(5-6)9-3-4-13-8/h1-2,5,9H,3-4H2 | | InChIKey | GZAJZBARYACGSO-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])c1cc2c(cc1)OCCN2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 6-Nitro-3,4-dihydro-2H-1,4-benzoxazine Usage And Synthesis |
| | 6-Nitro-3,4-dihydro-2H-1,4-benzoxazine Preparation Products And Raw materials |
|