| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-N-Boc-3-bromopiperidine Basic information |
| Product Name: | 1-N-Boc-3-bromopiperidine | | Synonyms: | 1-Piperidinecarboxylic acid, 3-bromo-, 1,1-dimethylethyl ester;1-Boc-3-bromopiperidine;3-Bromo-1-piperidinecarboxylic acid tert-butyl ester;R-1-Boc-3-Bromopiperidine;S-1-Boc-3-Bromopiperidine;1-Piperidinecarboxylic acid, 3-broMo;3-bromopiperidine-1-carboxylate;N-Boc-3-Bromopiperidine | | CAS: | 849928-26-3 | | MF: | C10H18BrNO2 | | MW: | 264.16 | | EINECS: | | | Product Categories: | | | Mol File: | 849928-26-3.mol |  |
| | 1-N-Boc-3-bromopiperidine Chemical Properties |
| Boiling point | 296.6±33.0 °C(Predicted) | | density | 1.327 | | refractive index | n/D 1.488 | | storage temp. | 2-8°C | | pka | -3.04±0.40(Predicted) | | form | liquid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H18BrNO2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7H2,1-3H3 | | InChIKey | YCUDHDNCZHPAJK-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCCC(Br)C1 |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-N-Boc-3-bromopiperidine Usage And Synthesis |
| Uses | 1-N-BOC-3-bromopiperidine is a valuable compound in organic synthesis, it is used as a protecting group for the piperidine nitrogen. | | Synthesis | 1-N-BOC-3-bromopiperidine can be synthesized from 3-bromopyrrolidine and sodium hydride in THF, and the BOC group can be removed using TFA. |
| | 1-N-Boc-3-bromopiperidine Preparation Products And Raw materials |
|