Bis(tetrabutylammonium) sulphate manufacturers
|
| | Bis(tetrabutylammonium) sulphate Basic information |
| | Bis(tetrabutylammonium) sulphate Chemical Properties |
| Boiling point | 84 °C | | density | 1.01 g/mL at 25 °C | | refractive index | n20/D 1.417 | | storage temp. | 2-8°C, sealed storage, away from moisture and light | | solubility | Fully miscible. | | form | Liquid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/2C16H36N.H2O4S/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h2*5-16H2,1-4H3;(H2,1,2,3,4)/q2*+1;/p-2 | | InChIKey | ZXUCBXRTRRIBSO-UHFFFAOYSA-L | | SMILES | [O-]S([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bis(tetrabutylammonium) sulphate Usage And Synthesis |
| Uses | Tetrabutylammonium Sulfate as catalysts in the polymerization of methyl methacrylate by electrolysis. |
| | Bis(tetrabutylammonium) sulphate Preparation Products And Raw materials |
|