|
|
| | N-DECYLTRIMETHOXYSILANE Basic information |
| Product Name: | N-DECYLTRIMETHOXYSILANE | | Synonyms: | N-DECYLTRIMETHOXYSILANE;KBM-3103C;KBM-310C;N-Decyltrimethoxysilan;Decyltrimethoxysilane >Silane, decyltrimethoxy-;ecyl(trimethoxy)silane;DK822 | | CAS: | 5575-48-4 | | MF: | C13H30O3Si | | MW: | 262.46 | | EINECS: | 422-350-7 | | Product Categories: | | | Mol File: | 5575-48-4.mol |  |
| | N-DECYLTRIMETHOXYSILANE Chemical Properties |
| Melting point | -37°C | | Boiling point | 115 °C | | density | 0.9 | | vapor pressure | 1hPa at 20℃ | | refractive index | 1.4220 | | Fp | 117°C | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.9 | | Water Solubility | Soluble in organic solvents. Insoluble in water. | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Moisture Sensitive | | BRN | 8625082 | | InChI | InChI=1S/C13H30O3Si/c1-5-6-7-8-9-10-11-12-13-17(14-2,15-3)16-4/h5-13H2,1-4H3 | | InChIKey | KQAHMVLQCSALSX-UHFFFAOYSA-N | | SMILES | [Si](CCCCCCCCCC)(OC)(OC)OC | | LogP | 3.75 at 25℃ |
| Provider | Language |
|
ALFA
| English |
| | N-DECYLTRIMETHOXYSILANE Usage And Synthesis |
| Uses | n-Decyltrimethoxysilane is used as a coupling agent and as a pharmaceutical intermediate. |
| | N-DECYLTRIMETHOXYSILANE Preparation Products And Raw materials |
|