|
|
| | 4-(4'-N-HEPTYLPHENYL)BENZOIC ACID Basic information |
| | 4-(4'-N-HEPTYLPHENYL)BENZOIC ACID Chemical Properties |
| Boiling point | 449.9±34.0 °C(Predicted) | | density | 1.048±0.06 g/cm3(Predicted) | | solubility | almost transparency in hot EtOH | | form | powder to crystal | | pka | 4.23±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C20H24O2/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-14-19(15-13-18)20(21)22/h8-15H,2-7H2,1H3,(H,21,22) | | InChIKey | XVROSBHWACAQRL-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(CCCCCCC)C=C2)=CC=C(C(O)=O)C=C1 | | CAS DataBase Reference | 58573-94-7(CAS DataBase Reference) |
| | 4-(4'-N-HEPTYLPHENYL)BENZOIC ACID Usage And Synthesis |
| | 4-(4'-N-HEPTYLPHENYL)BENZOIC ACID Preparation Products And Raw materials |
|