- 5-Bromo-2-tetralone
-
-
2026-07-08
- CAS:132095-53-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
- 5-Bromo-2-tetralone
-
- $1.00
-
2019-07-06
- CAS:132095-53-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | 5-Bromo-2-tetralone Basic information |
| Product Name: | 5-Bromo-2-tetralone | | Synonyms: | 5-BROMO-2-TETRALONE;5-Bromo-3,4-dihydro-1H-naphthalen-2-one;5-bromo-3,4-dihydronaphthalen-2(1H)-one;5-broMo-3;2(1H)-Naphthalenone,5-broMo-3,4-dihydro-;5-Bromo-3,4-dihydro-1H-phthalen-2-one;5-bromo-1,2,3,4-tetrahydronaphthalen-2-one | | CAS: | 132095-53-5 | | MF: | C10H9BrO | | MW: | 225.08 | | EINECS: | | | Product Categories: | | | Mol File: | 132095-53-5.mol |  |
| | 5-Bromo-2-tetralone Chemical Properties |
| Boiling point | 331.0±42.0 °C(Predicted) | | density | 1.511±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H9BrO/c11-10-3-1-2-7-6-8(12)4-5-9(7)10/h1-3H,4-6H2 | | InChIKey | DDVQSZNNPLLKCW-UHFFFAOYSA-N | | SMILES | C1C2=C(C(Br)=CC=C2)CCC1=O |
| | 5-Bromo-2-tetralone Usage And Synthesis |
| Uses | 5-Bromo-2-tetralone is a reagent in the preparation of 2-aminotetralins with high affinity and selectivity for dopamine D3 receptor. |
| | 5-Bromo-2-tetralone Preparation Products And Raw materials |
|