| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl 3,5-diethoxybenzoate Basic information |
| | Ethyl 3,5-diethoxybenzoate Chemical Properties |
| Boiling point | 112-113 °C0.2 mm Hg(lit.) | | density | 1.094 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.511(lit.) | | Fp | >230 °F | | Specific Gravity | 1.094 | | InChI | 1S/C13H18O4/c1-4-15-11-7-10(13(14)17-6-3)8-12(9-11)16-5-2/h7-9H,4-6H2,1-3H3 | | InChIKey | QILFPIREJVUYJP-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cc(OCC)cc(OCC)c1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Ethyl 3,5-diethoxybenzoate Usage And Synthesis |
| | Ethyl 3,5-diethoxybenzoate Preparation Products And Raw materials |
|