|
|
| | 2-Methyl-d3-1,4-naphthoquinone Basic information |
| | 2-Methyl-d3-1,4-naphthoquinone Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMSO : ≥ 125 mg/mL (713.47 mM) | | form | Solid | | color | Light yellow to yellow | | InChI | InChI=1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3/i1D3 | | InChIKey | MJVAVZPDRWSRRC-FIBGUPNXSA-N | | SMILES | C1(=CC(C2C=CC=CC=2C1=O)=O)C([2H])([2H])[2H] |
| | 2-Methyl-d3-1,4-naphthoquinone Usage And Synthesis |
| Uses | Isotope labelled d3; 1,4-Dihydro-1,4-dioxo-2-methylnaphthalene-d3; (Vitamin K3), precursor to various types of Vitamin K. Used as a micronutrient for livestock and pet foods. |
| | 2-Methyl-d3-1,4-naphthoquinone Preparation Products And Raw materials |
|