| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,4,5-Trichlorophenol-3,6-d2 Basic information |
| Product Name: | 2,4,5-Trichlorophenol-3,6-d2 | | Synonyms: | 2,4,5-TRICHLOROPHENOL (RING-D2);2,4,5-Trichlorophenol-d2;2,4,5-Trichlorophenol-3,6-d?;2,4,5-Trichlorophenol-3,6-d2 in isopropanol;2,4,5-Trichlorophenol-3,6-d2;2,4,5-Trichlorophenol D2 (3,6-D2);2,4,5-Trichlorophenol (ring-D?, 97-98%);2,4,5-Trichlorophenol-3,6-d2 | | CAS: | 93951-82-7 | | MF: | C6HCl3D2O | | MW: | 199.46 | | EINECS: | | | Product Categories: | Alphabetical Listings;Stable Isotopes | | Mol File: | 93951-82-7.mol |  |
| | 2,4,5-Trichlorophenol-3,6-d2 Chemical Properties |
| Melting point | 67-69 °C(lit.) | | Boiling point | 248 °C/740 mmHg(lit.) | | Fp | 133 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C6H3Cl3O/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H/i1D,2D | | InChIKey | LHJGJYXLEPZJPM-QDNHWIQGSA-N | | SMILES | [2H]c1c(O)c(Cl)c([2H])c(Cl)c1Cl | | CAS Number Unlabeled | 95-95-4 |
| Hazard Codes | Xn,N | | Risk Statements | 22-36/38-50/53 | | Safety Statements | 26-28-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Skin Irrit. 2 |
| | 2,4,5-Trichlorophenol-3,6-d2 Usage And Synthesis |
| Uses | 2,4,5-Trichlorophenol-d2 is the labelled analogue of 2,4,5-Trichlorophenol (T774145), which is used as a broad range pesticide against insects, fungi, vegetation and bacteria. It has become a common environmental contaminant and probable human carcinogen. |
| | 2,4,5-Trichlorophenol-3,6-d2 Preparation Products And Raw materials |
|