| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 1-methoxybicyclo[2.2.2]oct-5-ene-2-carboxylate Basic information |
| Product Name: | Methyl 1-methoxybicyclo[2.2.2]oct-5-ene-2-carboxylate | | Synonyms: | Methyl 1-methoxybicyclo[2.2.2]oct-5-ene-2-carboxylate, mixture of endo and exo;METHYL 1-METHOXYBICYCLO(2.2.2)OCT-5-ENE- 2-CARBOXYLATE, TECH., 90%;METHYL 1-METHOXYBICYCLO[2.2.2]OCT-5-ENE-2-CARBOXYLATE, 95%, MIXTURE OF ENDO AND EXO;1-Methoxybicyclo[2.2.2]oct-5-ene-2-carboxylic acid methyl ester;Bicyclo[2.2.2]oct-5-ene-2-carboxylic acid, 1-methoxy-, methyl ester;methyl 4-methoxybicyclo[2.2.2]oct-2-ene-5-carboxylate;CID 71311256;Methyl 1-methoxybicyclo[2.2.2]oct-5-ene-2-carboxylate | | CAS: | 5259-50-7 | | MF: | C11H16O3 | | MW: | 196.24 | | EINECS: | 226-064-1 | | Product Categories: | C10 to C11;Carbonyl Compounds;Esters | | Mol File: | 5259-50-7.mol | ![Methyl 1-methoxybicyclo[2.2.2]oct-5-ene-2-carboxylate Structure](CAS/GIF/5259-50-7.gif) |
| | Methyl 1-methoxybicyclo[2.2.2]oct-5-ene-2-carboxylate Chemical Properties |
| Boiling point | 105 °C17 mm Hg(lit.) | | density | 1.086 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.489(lit.) | | Fp | 218 °F | | InChI | 1S/C11H16O3/c1-13-10(12)9-7-8-3-5-11(9,14-2)6-4-8/h3,5,8-9H,4,6-7H2,1-2H3/t8-,9,11-/m1/s1 | | InChIKey | DFEJFZWTBMJTQN-RFSSFMFUSA-N | | SMILES | COC(=O)C1C[C@H]2CC[C@]1(OC)C=C2 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Methyl 1-methoxybicyclo[2.2.2]oct-5-ene-2-carboxylate Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | Methyl 1-methoxybicyclo[2.2.2]oct-5-ene-2-carboxylate may be used in synthesis of intermediates for chiral compounds. |
| | Methyl 1-methoxybicyclo[2.2.2]oct-5-ene-2-carboxylate Preparation Products And Raw materials |
|