| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Di-tert-butylcyclopentadiene Basic information |
| | Di-tert-butylcyclopentadiene Chemical Properties |
| Melting point | 69 °C | | density | 0.836 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.467 | | Fp | 9 °C | | storage temp. | 2-8°C | | form | liquid | | BRN | 3537135 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C13H22/c1-12(2,3)10-7-8-11(9-10)13(4,5)6/h7-10H,1-6H3 | | InChIKey | RADVPPBTEASJRZ-UHFFFAOYSA-N | | SMILES | CC(C)(C)C1C=CC(=C1)C(C)(C)C |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 3295 3/PG 2 | | WGK Germany | 3 | | F | 10 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | Di-tert-butylcyclopentadiene Usage And Synthesis |
| Uses | Di-tert-butylcyclopentadiene may be used in the preparation of 2,5,4′,6′-tetra-tert-butyl-5′H-spirocyclopentane-1,2′-cyclopenta[b][1,3]diselena-2,4-diene and 1,3,5,7-tetra-tert-butyl-3a,7a-dihydro-3a,7a-epi-selenodicyclopenta[b,e][1,4]diselenine. | | General Description | Preparation of di-tert-butylcyclopentadiene by phase-transfer-catalyzed alkylation has been reported. It reacts with excess potassium tert-butoxide in the presence of elemental selenium to yield cyclopentadienes bridged by two or three selenium atoms through one or two diselenoketal functionalities. It reacts with excess potassium tert-butoxide in the presence of elemental sulfur to yield cyclopentadienes bridged by sulfur atoms via one or two dithioketal functionalities. |
| | Di-tert-butylcyclopentadiene Preparation Products And Raw materials |
|