| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-Aminopurine nitrate salt
CAS:51-16-1
Purity:>=99% Package:250MG Remarks:A2380-250MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:2-Aminopurine nitrate salt >=99%
CAS:51-16-1
Purity:NULL Package:100mg;1g;250mg;500mg Remarks:NULL
|
|
| | 2-AMINOPURINE NITRATE SALT Basic information |
| | 2-AMINOPURINE NITRATE SALT Chemical Properties |
| solubility | water: 50 mg/mL, clear, faintly to light yellow | | form | powder | | biological source | synthetic | | Water Solubility | water: 50mg/mL, clear, faintly to light yellow | | InChI | 1S/C5H5N5.HNO3/c6-5-7-1-3-4(10-5)9-2-8-3;2-1(3)4/h1-2H,(H3,6,7,8,9,10);(H,2,3,4) | | InChIKey | PGDNOZBGABWZLD-UHFFFAOYSA-N | | SMILES | O[N+]([O-])=O.Nc1ncc2[nH]cnc2n1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | UO7505700 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-AMINOPURINE NITRATE SALT Usage And Synthesis |
| Uses | 2-Aminopurine (2-AP) is used to specifically inhibit double-stranded RNA-dependent protein kinase, protein kinase R (PKR). |
| | 2-AMINOPURINE NITRATE SALT Preparation Products And Raw materials |
|