|
|
| | (R)-4-BENZYL-1,3-OXAZOLIDINE-2-THIONE Basic information |
| Product Name: | (R)-4-BENZYL-1,3-OXAZOLIDINE-2-THIONE | | Synonyms: | (R)-4-BENZYL-1,3-OXAZOLIDINE-2-THIONE;(R)-4-BENZYLOXAZOLIDINE-2-THIONE;(R)-4-Benzyloxazolidine-2-thione,99%e.e.;(R)-4-Benzyloxazolidine-2-thione;(4R)-4-benzyl-1,3-oxazolidine-2-thione;2-Oxazolidinethione, 4-(phenylmethyl)-, (4R)-;(R)-4-Benzyloxazolidine-2-thione >=96.0% (HPLC);(R)-4-Benzyloxazolidine-2-thione | | CAS: | 190970-58-2 | | MF: | C10H11NOS | | MW: | 193.27 | | EINECS: | | | Product Categories: | | | Mol File: | 190970-58-2.mol |  |
| | (R)-4-BENZYL-1,3-OXAZOLIDINE-2-THIONE Chemical Properties |
| Melting point | 63-67 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C10H11NOS/c13-10-11-9(7-12-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,13)/t9-/m1/s1 | | InChIKey | WJSUXYCBZFLXIK-SECBINFHSA-N | | SMILES | S=C1N[C@@H](CO1)Cc2ccccc2 |
| Hazard Codes | Xi | | WGK Germany | 3 | | F | 10-23 | | Hazard Note | Irritant | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | (R)-4-BENZYL-1,3-OXAZOLIDINE-2-THIONE Usage And Synthesis |
| | (R)-4-BENZYL-1,3-OXAZOLIDINE-2-THIONE Preparation Products And Raw materials |
|