|
|
| | Rhodium(II) trifluoroacetate dimer Basic information |
| Product Name: | Rhodium(II) trifluoroacetate dimer | | Synonyms: | RHODIUM(II) TRIFLUOROACETATE DIMER;Rhodium(I) trifluoroacetate dimer;Rhodiumtrifluoroacetate;Rhodium(II) trifluoroacetate;Rhodium(II)trifluoroacetatedimer,min.95%;trifluoroacetic acid rhodium(ii) salt dimer;Bis-(trifluoroacetic acid rhodium salt);Rhodium(II) trifluoroacetate dimer, min. 95% | | CAS: | 31126-95-1 | | MF: | C8F12O8Rh2 | | MW: | 657.87 | | EINECS: | | | Product Categories: | Rh;metal acetate salt | | Mol File: | 31126-95-1.mol |  |
| | Rhodium(II) trifluoroacetate dimer Chemical Properties |
| solubility | sol MeCN, DMSO, pyridine; slightly sol dichloromethane, benzene. | | form | Crystalline Powder | | color | Green | | Stability: | hygroscopic | | InChI | InChI=1S/4C2HF3O2.2Rh/c4*3-2(4,5)1(6)7;;/h4*(H,6,7);;/q;;;;2*+2/p-4 | | InChIKey | PQEXTYUESSEHKW-UHFFFAOYSA-J | | SMILES | C(C1=O[Rh+2]234O=C(C(F)(F)F)[O-][Rh+2]2(O=C(C(F)(F)F)[O-]3)(O=C(C(F)(F)F)[O-]4)[O-]1)(F)(F)F |
| | Rhodium(II) trifluoroacetate dimer Usage And Synthesis |
| Chemical Properties | green | | Uses | Used in the preparation of isomerically pure α,β-unsaturated carbonyl compounds and the preparation of building blocks for one-, two-, and three-dimensional molecular solids. | | reaction suitability | reagent type: catalyst | | Synthesis | Rhodium(II) trifluoroacetate dimer is prepared ?from Dirhodium(II) Tetraacetate by ligand displacement in refluxing trifluoroacetic acid containing trifluoroacetic anhydride. |
| | Rhodium(II) trifluoroacetate dimer Preparation Products And Raw materials |
|