|
|
| | 4-(2-Methoxy-benzyl)-piperidine hydrochloride Basic information |
| | 4-(2-Methoxy-benzyl)-piperidine hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C13H19NO.ClH/c1-15-13-5-3-2-4-12(13)10-11-6-8-14-9-7-11;/h2-5,11,14H,6-10H2,1H3;1H | | InChIKey | FOGMNBVOKCFRAG-UHFFFAOYSA-N | | SMILES | COC1=C(C=CC=C1)CC2CCNCC2.Cl |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-(2-Methoxy-benzyl)-piperidine hydrochloride Usage And Synthesis |
| | 4-(2-Methoxy-benzyl)-piperidine hydrochloride Preparation Products And Raw materials |
|