|
|
| | 2-[4-Fluoro-3-(trifluoromethyl)phenyl]ethanol Basic information |
| | 2-[4-Fluoro-3-(trifluoromethyl)phenyl]ethanol Chemical Properties |
| Boiling point | 218.9±35.0 °C(Predicted) | | density | 1.321±0.06 g/cm3(Predicted) | | refractive index | 1.4565 | | pka | 14.62±0.10(Predicted) | | form | solid | | InChI | 1S/C9H8F4O/c10-8-2-1-6(3-4-14)5-7(8)9(11,12)13/h1-2,5,14H,3-4H2 | | InChIKey | WNWSWMPFXNNAQT-UHFFFAOYSA-N | | SMILES | OCCC1=CC=C(C(C(F)(F)F)=C1)F |
| WGK Germany | WGK 3 | | HS Code | 2905599890 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-[4-Fluoro-3-(trifluoromethyl)phenyl]ethanol Usage And Synthesis |
| | 2-[4-Fluoro-3-(trifluoromethyl)phenyl]ethanol Preparation Products And Raw materials |
|