| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(-)-2,2-Dimethyl-5-oxo-1,3-dioxolane-4-acetic acid Basic information |
| Product Name: | (R)-(-)-2,2-Dimethyl-5-oxo-1,3-dioxolane-4-acetic acid | | Synonyms: | (R)-(-)-2,2-Dimethyl-5-oxo-1,3-dioxolane-4-acetic acid 95%;[(4R)-2,2-DIMETHYL-5-OXO-1,3-DIOXOLAN-4-YL]ACETIC ACID;(R)-(-)-2,2-dimethyl-5-oxo-1,3-dioxolane-4-acetic;[(R)-2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl]acetic Acid;2-((R)-2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)acetic Acid;(R)-2-(2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)acetic acid;(R)-2,2-DiMethyl-5-oxo-;(R)-(-)-2,2-DiMethyl-5-oxo-1,3-dioxolane-4-acetic acid,95% | | CAS: | 113278-68-5 | | MF: | C7H10O5 | | MW: | 174.15 | | EINECS: | | | Product Categories: | Chiral Reagents;Heterocycles;Carboxylic Acids;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 113278-68-5.mol |  |
| | (R)-(-)-2,2-Dimethyl-5-oxo-1,3-dioxolane-4-acetic acid Chemical Properties |
| Melting point | 95-98°C | | Boiling point | 341.4±17.0 °C(Predicted) | | density | 1.262±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Dichloromethane, Ethyl Acetate, Methanol | | form | Solid | | pka | 3.96±0.10(Predicted) | | color | Off-White | | Optical Rotation | [α]20/D 3.5°, c = 1 in chloroform | | InChI | 1S/C7H10O5/c1-7(2)11-4(3-5(8)9)6(10)12-7/h4H,3H2,1-2H3,(H,8,9)/t4-/m1/s1 | | InChIKey | IDQOCLIWDMZKBZ-SCSAIBSYSA-N | | SMILES | CC1(C)O[C@H](CC(O)=O)C(=O)O1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(-)-2,2-Dimethyl-5-oxo-1,3-dioxolane-4-acetic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An optically active inhibitor. | | General Description | (R)-()-2,2-Dimethyl-5-oxo-1,3-dioxolane-4-acetic acid can be used as an intermediate/starting material in the synthesis of (R)-isoserine, a glucagon receptor antagonist, blepharismone, and pheromone of Blepharisma japonicum. |
| | (R)-(-)-2,2-Dimethyl-5-oxo-1,3-dioxolane-4-acetic acid Preparation Products And Raw materials |
|