- EB-47
-
- $62.00
-
2026-07-27
- CAS:366454-36-6
- Purity: 99.86%
- Supply Ability: 10g
- EB-47
-
- $62.00
-
2026-07-27
- CAS:366454-36-6
- Purity: 99.86%
- Supply Ability: 10g
|
| Product Name: | EB-47 | | Synonyms: | EB-47;4-[1-(6-AMino-9H-purin-9-yl)-1-deoxy-β-D-
ribofuranuronoyl]-N-(2,3-dihydro-1-oxo-1H-isoindol-4-yl)-1-piperazineacetaMide Dihydrochloride;5'-Deoxy-5'-[4-[2-[(2,3-dihydro-1-oxo-1H-isoindol-4-yl)aMino]-2-oxoethyl]-1-piperazinyl]-5'-oxoadenosine Dihydrochloride;EB 47 DIHYDROCHLORIDE;PARP Inhibitor IX, EB-47;Adenosine, 5'-deoxy-5'-[4-[2-[(2,3-dihydro-1-oxo-1H-isoindol-4-yl)amino]-2-oxoethyl]-1-piperazinyl]-5'-oxo-;EB-47, 10 mM in DMSO | | CAS: | 366454-36-6 | | MF: | C24H27N9O6 | | MW: | 537.53 | | EINECS: | | | Product Categories: | PARP Poly(ADP-ribose) Polymerase;Enzyme Inhibitors by Enzyme;P to | | Mol File: | Mol File |  |
| | EB-47 Chemical Properties |
| density | 1.83±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | H2O: 10 mg/mL, soluble | | form | solid | | pka | 12.99±0.70(Predicted) | | color | white | | Water Solubility | water: 50mg/mL | | InChIKey | DDFLFKTXUWPNMV-UAKAABGRSA-N | | SMILES | Nc1ncnc2n(cnc12)[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)C(=O)N4CCN(CC4)CC(=O)Nc5cccc6C(=O)NCc56 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | EB-47 Usage And Synthesis |
| Uses | EB 47 is a potent inhibitor of poly(ADP-ribose) polymerase-1 (PARP-1). Poly(ADP-ribose) polymerases (PARPs) play a major role in cellular survival and maintenance of energy stores after genotoxic insult. | | Biological Activity | Cell permeable: yes', 'Primary Target
PARP-1', 'Product does not compete with ATP.', 'Reversible: no | | in vivo | EB-47 (2 μM; 5 days) decreases the number of embryo implantation sites and blastocysts at day 5. PARP1 participates in the process of embryo implantation[3]. | | IC 50 | ARTD1/PARP1: 45 nM (IC50) |
| | EB-47 Preparation Products And Raw materials |
|