| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | DL-Malic acid di-n-butyl ester Basic information |
| Product Name: | DL-Malic acid di-n-butyl ester | | Synonyms: | Butanedioic acid, hydroxy-, dibutyl ester, (±Butanedioic acid, hydroxy-, dibutyl ester, (.+/-.)-;dibutyl(+-)-hydroxybutanedioate;dibutylester,(+-)-malicaci;dl-dibutylmalate;ENT-337;hydroxy-,dibutylester,(+-)-butanedioicaci;Butanedioic acid,2-hydroxy-, 1,4-dibutyl ester | | CAS: | 6280-99-5 | | MF: | C12H22O5 | | MW: | 246.3 | | EINECS: | 228-485-6 | | Product Categories: | | | Mol File: | 6280-99-5.mol |  |
| | DL-Malic acid di-n-butyl ester Chemical Properties |
| Boiling point | 299°C (estimate) | | density | 1.04 | | refractive index | 1.4390 to 1.4420 | | pka | 12.14±0.20(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | 1S/C12H22O5/c1-3-5-7-16-11(14)9-10(13)12(15)17-8-6-4-2/h10,13H,3-9H2,1-2H3 | | InChIKey | PDSCSYLDRHAHOX-UHFFFAOYSA-N | | SMILES | CCCCOC(=O)CC(O)C(=O)OCCCC | | LogP | 2.338 (est) | | EPA Substance Registry System | Butanedioic acid, hydroxy-, dibutyl ester (6280-99-5) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2917.19.7050 | | Storage Class | 11 - Combustible Solids |
| | DL-Malic acid di-n-butyl ester Usage And Synthesis |
| Uses | 1,4-Dibutyl 2-Hydroxybutanedioate is used in preparation of α-carboxy-ω-hydroxy polyoxyalkylenes. | | Definition | ChEBI: Dibutyl malate is a 3-hydroxy carboxylic acid. |
| | DL-Malic acid di-n-butyl ester Preparation Products And Raw materials |
|