|
|
| | CHEMBRDG-BB 4013289 Basic information |
| Product Name: | CHEMBRDG-BB 4013289 | | Synonyms: | CHEMBRDG-BB 4013289;9-METHYL-2,3,4,9-TETRAHYDRO-1H-CARBAZOL-1-ONE;9-methyl-3,4-dihydro-2H-carbazol-1-one;9-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-one(SALTDATA: FREE);1H-Carbazol-1-one, 2,3,4,9-tetrahydro-9-methyl- | | CAS: | 1485-19-4 | | MF: | C13H13NO | | MW: | 199.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1485-19-4.mol |  |
| | CHEMBRDG-BB 4013289 Chemical Properties |
| form | solid | | InChI | 1S/C13H13NO/c1-14-11-7-3-2-5-9(11)10-6-4-8-12(15)13(10)14/h2-3,5,7H,4,6,8H2,1H3 | | InChIKey | IGFSAVURETUQDW-UHFFFAOYSA-N | | SMILES | O=C1C(N(C)C2=C3C=CC=C2)=C3CCC1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | CHEMBRDG-BB 4013289 Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 88, p. 1049, 1966 DOI: 10.1021/ja00957a035 |
| | CHEMBRDG-BB 4013289 Preparation Products And Raw materials |
|