| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2,6-Dimethylphenyl isothiocyanate manufacturers
|
| | 2,6-Dimethylphenyl isothiocyanate Basic information |
| Product Name: | 2,6-Dimethylphenyl isothiocyanate | | Synonyms: | 2,6-Dimethylphenyl-1-isothiocyanate;2,6-Xylyl isothiocyanate;2-Isothiocyanato-1,3-dimethylbenzene;Benzene, 2-isothiocyanato-1,3-dimethyl-;Isothiocyanic acid, 2,6-xylyl ester;2,6-Dimethylphenyl isothiocyanate,98%;2,6-Dimethylphenyl isothiocyanate 98%;2,6-Dimethylphenyl isothiocyate, 98% | | CAS: | 19241-16-8 | | MF: | C9H9NS | | MW: | 163.24 | | EINECS: | 242-906-0 | | Product Categories: | Organic Building Blocks;Sulfur Compounds;Thiocyanates/Isothiocyanates | | Mol File: | 19241-16-8.mol |  |
| | 2,6-Dimethylphenyl isothiocyanate Chemical Properties |
| Boiling point | 247 °C (lit.) | | density | 1.085 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.627(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | Specific Gravity | 1.085 | | Water Solubility | Hydrolyzes in water. | | Sensitive | Moisture Sensitive | | BRN | 637195 | | InChI | InChI=1S/C9H9NS/c1-7-4-3-5-8(2)9(7)10-6-11/h3-5H,1-2H3 | | InChIKey | UULUECCNPPJFBU-UHFFFAOYSA-N | | SMILES | C1(C)=CC=CC(C)=C1N=C=S | | CAS DataBase Reference | 19241-16-8(CAS DataBase Reference) |
| Hazard Codes | Xn,C,Xi | | Risk Statements | 22-36/37/38-43 | | Safety Statements | 26-36 | | RIDADR | 2810 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 2,6-Dimethylphenyl isothiocyanate Usage And Synthesis |
| Chemical Properties | clear light yellow liquid | | Uses | 2,6-Dimethylphenyl isocyanate has been used in the preparation of derivatized β-cyclodextrins, used as chiral stationary phase in normal-phase liquid chromatography, tris( 2,6-dimethylphenylimido)methylrhenium (VII), 1-(2-isopropylphenyl)-3-(2,6-dimethylphenyl)urea. |
| | 2,6-Dimethylphenyl isothiocyanate Preparation Products And Raw materials |
|