|
|
| | 4-tert-Butylcyclohexyl acrylate Basic information |
| | 4-tert-Butylcyclohexyl acrylate Chemical Properties |
| Boiling point | 259.2±9.0 °C(Predicted) | | density | 1.108 g/mL at 25 °C(lit.) | | vapor pressure | 6hPa at 20℃ | | refractive index | n20/D 1.464(lit.) | | Fp | 102 °C | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Water Solubility | 5mg/L at 20℃ | | InChI | InChI=1S/C13H22O2/c1-5-12(14)15-11-8-6-10(7-9-11)13(2,3)4/h5,10-11H,1,6-9H2,2-4H3 | | InChIKey | LAIJAUHBAWLPCO-UHFFFAOYSA-N | | SMILES | C(OC1CCC(C(C)(C)C)CC1)(=O)C=C | | LogP | 5.6 at 23℃ |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-36-61-28 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2916.12.5050 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-tert-Butylcyclohexyl acrylate Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | 4-tert-Butylcyclohexyl acrylate Preparation Products And Raw materials |
|