|
|
| | H-Lys(Me)3-OH chloride Basic information |
| Product Name: | H-Lys(Me)3-OH chloride | | Synonyms: | H-N-EPSILON-(TRIMETHYL)-L-LYSINE CHLORIDE;Nε,Nε,Nε-triMethyl-L-lysine dihydrochloride;Nε-(trimethyl)-L-lysine chloride;Nε,Nε,Nε-Trimethyllysine hydrochloride;Lys(Me)3-OH Chloride;Nepsilon,Nepsilon,Nepsilon-Trimethyllysine hydrochloride >=97% (TLC);Nε,Nε,Nε-Trimethyllysine chloride;(S)-5-Amino-5-carboxy-N,N,N-trimethylpentan-1-aminium chloride | | CAS: | 55528-53-5 | | MF: | C9H21ClN2O2 | | MW: | 224.73 | | EINECS: | | | Product Categories: | Amino Acid Library;Amino AcidMetabolomics;Metabolic Libraries;Metabolic Pathways;Metabolites and Cofactors on the Metabolic Pathways Chart | | Mol File: | 55528-53-5.mol |  |
| | H-Lys(Me)3-OH chloride Chemical Properties |
| storage temp. | Store at 0°C | | solubility | PBS (pH 7.2):1.0(Max Conc. mg/mL);4.45(Max Conc. mM) | | form | A solid | | color | White to off-white | | InChI | 1S/C9H20N2O2.ClH/c1-11(2,3)7-5-4-6-8(10)9(12)13;/h8H,4-7,10H2,1-3H3;1H/t8-;/m0./s1 | | InChIKey | ZKIJKCHCMFGMCM-QRPNPIFTSA-N | | SMILES | [Cl-].C[N+](C)(C)CCCC[C@H](N)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-Lys(Me)3-OH chloride Usage And Synthesis |
| Uses | Nε,Nε,Nε-Trimethyllysine chloride serves as a precursor for gut flora-dependent formation of N,N,N-trimethyl-5-aminovaleric acid (TMAVA)[1]. | | References | [1] Zhao M, et al. TMAVA, a Metabolite of Intestinal Microbes, Is Increased in Plasma From Patients With Liver Steatosis, Inhibits γ-Butyrobetaine Hydroxylase, and Exacerbates Fatty Liver in Mice. Gastroenterology. 2020;158(8):2266-2281.e27. DOI:10.1053/j.gastro.2020.02.033 |
| | H-Lys(Me)3-OH chloride Preparation Products And Raw materials |
|