|
|
| | H-LYS(ME)3-OH CHLORIDE Basic information |
| | H-LYS(ME)3-OH CHLORIDE Chemical Properties |
| storage temp. | Store at 0°C | | solubility | PBS (pH 7.2):1.0(Max Conc. mg/mL);4.45(Max Conc. mM) | | form | A solid | | color | White to off-white | | InChI | 1S/C9H20N2O2.ClH/c1-11(2,3)7-5-4-6-8(10)9(12)13;/h8H,4-7,10H2,1-3H3;1H/t8-;/m0./s1 | | InChIKey | ZKIJKCHCMFGMCM-QRPNPIFTSA-N | | SMILES | [Cl-].C[N+](C)(C)CCCC[C@H](N)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-LYS(ME)3-OH CHLORIDE Usage And Synthesis |
| Uses | Nε,Nε,Nε-Trimethyllysine chloride serves as a precursor for gut flora-dependent formation of N,N,N-trimethyl-5-aminovaleric acid (TMAVA)[1]. | | References | [1] Zhao M, et al. TMAVA, a Metabolite of Intestinal Microbes, Is Increased in Plasma From Patients With Liver Steatosis, Inhibits γ-Butyrobetaine Hydroxylase, and Exacerbates Fatty Liver in Mice. Gastroenterology. 2020;158(8):2266-2281.e27. DOI:10.1053/j.gastro.2020.02.033 |
| | H-LYS(ME)3-OH CHLORIDE Preparation Products And Raw materials |
|