|
|
| | 4-Amino-5,8-dichloro-2-methylquinoline Basic information |
| | 4-Amino-5,8-dichloro-2-methylquinoline Chemical Properties |
| form | solid | | InChI | 1S/C10H8Cl2N2/c1-5-4-8(13)9-6(11)2-3-7(12)10(9)14-5/h2-4H,1H3,(H2,13,14) | | InChIKey | LYJNAWSOSQSLIL-UHFFFAOYSA-N | | SMILES | Cc1cc(N)c2c(Cl)ccc(Cl)c2n1 |
| Hazard Codes | T | | Risk Statements | 25-41 | | Safety Statements | 26-39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
| | 4-Amino-5,8-dichloro-2-methylquinoline Usage And Synthesis |
| | 4-Amino-5,8-dichloro-2-methylquinoline Preparation Products And Raw materials |
|