| Company Name: |
parabiochem |
| Tel: |
025-83453382-8005 |
| Email: |
sale@parabiochem.com |
4-(6-Acryloxy-hex-1-yl-oxy)phenyl 4-(hexyloxy)benzoate manufacturers
|
| | 4-(6-Acryloxy-hex-1-yl-oxy)phenyl 4-(hexyloxy)benzoate Basic information |
| Product Name: | 4-(6-Acryloxy-hex-1-yl-oxy)phenyl 4-(hexyloxy)benzoate | | Synonyms: | Benzoic acid, 4-(hexyloxy)-, 4-[[6-[(1-oxo-2-propen-1-yl)oxy]hexyl]oxy]phenyl ester;4-(6-prop-2-enoyloxyhexoxy)phenyl]4-hexoxybenzoate;4-[[6-[(1-Oxo-2-propen-1-yl)oxy]hexyl]oxy]phenyl 4-(hexyloxy)benzoate;4-6-(1-Oxo-allyloxy)hexyloxyphenyl 4-(hexyloxy)-benzoate;4-(6-ACRoxy-hex-1-yl-oxy)phenyl 4-(hexyloxy)benzoate;4-(6-Acryloxy-hex-1-yl-oxy)phenyl 4-(hexyloxy)benzoate | | CAS: | 863394-23-4 | | MF: | C28H36O6 | | MW: | 468.58 | | EINECS: | | | Product Categories: | | | Mol File: | 863394-23-4.mol |  |
| | 4-(6-Acryloxy-hex-1-yl-oxy)phenyl 4-(hexyloxy)benzoate Chemical Properties |
| Boiling point | 591.4±45.0 °C(Predicted) | | density | 1.079±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C28H36O6/c1-3-5-6-9-20-31-24-14-12-23(13-15-24)28(30)34-26-18-16-25(17-19-26)32-21-10-7-8-11-22-33-27(29)4-2/h4,12-19H,2-3,5-11,20-22H2,1H3 | | InChIKey | VXCYVCUKVGUJMW-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(OCCCCCCOC(=O)C=C)C=C1)(=O)C1=CC=C(OCCCCCC)C=C1 |
| | 4-(6-Acryloxy-hex-1-yl-oxy)phenyl 4-(hexyloxy)benzoate Usage And Synthesis |
| Chemical Properties | White to off-white powder |
| | 4-(6-Acryloxy-hex-1-yl-oxy)phenyl 4-(hexyloxy)benzoate Preparation Products And Raw materials |
|