|
|
| | Isofenphos-methyl Basic information |
| | Isofenphos-methyl Chemical Properties |
| Boiling point | 397.5±44.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | -0.41±0.70(Predicted) | | Stability: | Hygroscopic | | Major Application | agriculture environmental | | InChI | 1S/C14H22NO4PS/c1-10(2)15-20(21,17-5)19-13-9-7-6-8-12(13)14(16)18-11(3)4/h6-11H,1-5H3,(H,15,21) | | InChIKey | IXTOWLKEARFCCP-UHFFFAOYSA-N | | SMILES | COP(=S)(NC(C)C)Oc1ccccc1C(=O)OC(C)C |
| Hazard Codes | T,N | | Risk Statements | 24/25-50/53 | | Safety Statements | 36/37-45-60-61 | | RIDADR | UN3278 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Acute 1 |
| | Isofenphos-methyl Usage And Synthesis |
| Uses | Isofenphos-methyl-D7 (N-isopropyl-D7 ) is an isotope labeled compound of Methyl Isofenphos (M314350). Methyl Isofenphos is an organophosphorus compound, that according to biological studies, can cause acute toxicity to animals. | | Production Methods | Isofenphos-methyl is commercially produced through a multi-step chemical synthesis involving phosphorus-containing intermediates. Key raw materials include phosphorus trichloride, isopropyl alcohol, and salicylic acid derivatives. The synthesis typically involves esterification and phosphinothioylation reactions to form the active compound. | | Mechanism of action | Selective with contact and stomach action. Acetylcholine esterase inhibitor. | | Pesticide Type | Insecticide |
| | Isofenphos-methyl Preparation Products And Raw materials |
|