- 4-N-BUTYLCYCLOHEXANONE
-
- $1.00
-
2020-01-10
- CAS:61203-82-5
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons/month
|
| | 4-n-Butylcyclohexanone Basic information |
| | 4-n-Butylcyclohexanone Chemical Properties |
| Melting point | 101-102 °C | | Boiling point | 106-109 °C(Press: 18 Torr) | | density | 0.888±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C10H18O/c1-2-3-4-9-5-7-10(11)8-6-9/h9H,2-8H2,1H3 | | InChIKey | CKUNTDNDGXPOPB-UHFFFAOYSA-N | | SMILES | C1(=O)CCC(CCCC)CC1 |
| | 4-n-Butylcyclohexanone Usage And Synthesis |
| Uses | Intermediates of Liquid Crystals |
| | 4-n-Butylcyclohexanone Preparation Products And Raw materials |
|