| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | N'-Hydroxycyclopropanecarboximidamide Basic information |
| Product Name: | N'-Hydroxycyclopropanecarboximidamide | | Synonyms: | AKOS B030098;N-HYDROXYCYCLOPROPANECARBOXAMIDINE;Cyclopropanecarboximidamide, N-hydroxy- (9CI);N'-Hydroxycyclopropanecarboximideamide;Cyclopropanecarboxamide oxime;(Z)-N'-hydroxycyclopropanecarboxamidine;Cyclopropanecarboximidamide,N-hydroxy-;N'-Hydroxycyclopropanecarboximidamide | | CAS: | 51285-13-3 | | MF: | C4H8N2O | | MW: | 100.12 | | EINECS: | | | Product Categories: | AMIDINE;OXIME;pharmacetical | | Mol File: | 51285-13-3.mol |  |
| | N'-Hydroxycyclopropanecarboximidamide Chemical Properties |
| Melting point | 34-40° | | Boiling point | 176.0±23.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 15.04±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H8N2O/c5-4(6-7)3-1-2-3/h3,7H,1-2H2,(H2,5,6) | | InChIKey | OMCUPXRCMTUDHI-UHFFFAOYSA-N | | SMILES | C1(C(NO)=N)CC1 | | CAS DataBase Reference | 51285-13-3 |
| | N'-Hydroxycyclopropanecarboximidamide Usage And Synthesis |
| Uses | N''-Hydroxycyclopropanecarboximidamide | | Synthesis | General procedure for the synthesis of N-hydroxycyclopropanecarboxamidine from cyclopropanecarbonitrile: A mixture of cyclopropanecarbonitrile (5 g, 74.6 mmol) and hydroxylamine (50 wt% aqueous, 5.91 g, 89.5 mmol) in ethanol (15 mL) was reacted with stirring at 80 °C overnight. Upon completion of the reaction, the mixture was cooled to room temperature and the volatile solvent was subsequently removed under reduced pressure to afford the crude product N-hydroxycyclopropanecarboxamidine (7.0 g, 94% yield). The product could be directly used in the subsequent reaction without further purification. The product was analyzed by LCMS showing m/z = 101.2 [M + H]+, which was consistent with the theoretically calculated value (exact mass of C4H8N2O: 100.1).1H NMR (400 MHz, DMSO-d6) data were as follows: δ 0.54-0.60 (m, 2H), 0.61-0.66 (m, 2H), 1.28-1.36 (m, 1H) , 5.18 (bs, 2H), 8.68 (bs, 1H). | | References | [1] Patent: WO2012/145361, 2012, A1. Location in patent: Page/Page column 167; 168 [2] Patent: WO2011/104680, 2011, A1. Location in patent: Page/Page column 82 [3] Patent: US5464848, 1995, A [4] Patent: US5106853, 1992, A [5] Patent: US5124460, 1992, A |
| | N'-Hydroxycyclopropanecarboximidamide Preparation Products And Raw materials |
|