|
|
| | 1,2-Benzisoxazole-3-methanesulfonic acid sodium salt Basic information |
| | 1,2-Benzisoxazole-3-methanesulfonic acid sodium salt Chemical Properties |
| Melting point | 275°C dec. | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C8H7NO4S.Na.H/c10-14(11,12)5-7-6-3-1-2-4-8(6)13-9-7;;/h1-4H,5H2,(H,10,11,12);; | | InChIKey | YQSCJDMJHSSTIO-UHFFFAOYSA-N | | SMILES | C(C1=NOC2C=CC=CC1=2)S(O)(=O)=O.[NaH] | | CAS DataBase Reference | 73101-64-1(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids |
| | 1,2-Benzisoxazole-3-methanesulfonic acid sodium salt Usage And Synthesis |
| Chemical Properties | Off-White Powder | | Uses | Zonisamide intermediate |
| | 1,2-Benzisoxazole-3-methanesulfonic acid sodium salt Preparation Products And Raw materials |
|