|
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide Suppliers list
|
| Company Name: |
Lianhe Aigen Pharmatech Co.,Ltd. |
| Tel: |
+86-18918657159; +86-18918657159 |
| Email: |
sales@lianhe-aigen.com |
| Products Intro: |
Product Name:1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide
CAS:163755-62-2
Purity:98% Package:10g, 50g, 100g ,500g,1kg
|
|
|
|
|
| Company Name: |
Jinan Carbotang Biotech Co.,Ltd. |
| Tel: |
+8615866703830 |
| Email: |
figo.gao@foxmail.com |
| Products Intro: |
Product Name:1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide
CAS:163755-62-2
Purity:98% Package:5KG;1KG
|
|
|
|
|
|
| | 1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide Basic information |
| Product Name: | 1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide | | Synonyms: | 1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide;T4P 50%（wt%）solution in diethyl carbonate;butylphosphate anhydride;T4P 50% butylphosphonic anhydride CH3CN solution;T4P? 50%(wt%) solution in Dichloromethane;T4P 50%(wt%)solution in THF;T4P 50%(wt%)solution in ethyl methyl carbonate;2,4,6-Tributyl-1,3,5,2,4,6-trioxatriphosphinane 2,4,6-trioxide(50% in EA),50% ethyl acetate solution | | CAS: | 163755-62-2 | | MF: | C12H27O6P3 | | MW: | 360.26 | | EINECS: | | | Product Categories: | | | Mol File: | 163755-62-2.mol |  |
| | 1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide Chemical Properties |
| Boiling point | 397.5±25.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C12H27O6P3/c1-4-7-10-19(13)16-20(14,11-8-5-2)18-21(15,17-19)12-9-6-3/h4-12H2,1-3H3 | | InChIKey | VUNNHQCURTZIHD-UHFFFAOYSA-N | | SMILES | O1P(=O)(CCCC)OP(=O)(CCCC)OP1(=O)CCCC |
| RIDADR | UN2924 | | HazardClass | 3, 8 |
| | 1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide Usage And Synthesis |
| Uses | 1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide can be used as a condensing agent in organic synthesis, as well as as a functional additive and raw material for pharmaceutical synthesis.
|
| | 1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tributyl-, 2,4,6-trioxide Preparation Products And Raw materials |
|