2-chloro-4'-phenylbenzophenone manufacturers
|
| | 2-chloro-4'-phenylbenzophenone Basic information | | Uses |
| Product Name: | 2-chloro-4'-phenylbenzophenone | | Synonyms: | 2-chloro-4'-phenylbenzophenone;Methanone, (1,1-biphenyl)-4-yl(2-chlorophenyl)-;1,1'-Biphenyl-4-yl(2-chlorophenyl)methanone;(2-chlorophenyl)-(4-phenylphenyl)methanone;4-Biphenylyl(2-chlorophenyl)methanone;1,1'-Biphenyl]-4-yl(2-chlorophenyl)methanone | | CAS: | 34701-98-9 | | MF: | C19H13ClO | | MW: | 292.76 | | EINECS: | 252-160-8 | | Product Categories: | | | Mol File: | 34701-98-9.mol |  |
| | 2-chloro-4'-phenylbenzophenone Chemical Properties |
| Melting point | 94 °C | | Boiling point | 449.0±28.0 °C(Predicted) | | density | 1.195±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C19H13ClO/c20-18-9-5-4-8-17(18)19(21)16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-13H | | InChIKey | ZSENJSDVZBWPKH-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C2=CC=CC=C2)C=C1)(C1=CC=CC=C1Cl)=O |
| | 2-chloro-4'-phenylbenzophenone Usage And Synthesis |
| Uses | 2-Chloro-4-phenylbenzophenone is a ketone derivative used as a photoinitiator. |
| | 2-chloro-4'-phenylbenzophenone Preparation Products And Raw materials |
|