6-[[(4-methylphenyl)sulphonyl]amino]hexanoic acid manufacturers
- MSA 75
-
-
2026-09-11
- CAS:78521-39-8
- Min. Order: 1KG
- Purity: 0.98
- Supply Ability: 40000 KG
|
| | 6-[[(4-methylphenyl)sulphonyl]amino]hexanoic acid Basic information | | Application |
| Product Name: | 6-[[(4-methylphenyl)sulphonyl]amino]hexanoic acid | | Synonyms: | 6-[[(4-methylphenyl)sulphonyl]amino]hexanoic acid;4-Methylphenylsulfonylaminohexanoicacid;6-[[(4-methylphenyl) sulfonyl] amino] -Hexanoic acid;4-METHYLPHENYLSULFONYLAMINOHEXANOIC ACID OR N-(HEXANOIC ACID ) P-TOLUENESULFONAMIDE;Einecs 278-934-5;Hexanoic acid, 6-(((4-methylphenyl)sulfonyl)amino)-;6-(4-methylphenylsulfonamido)hexanoic acid;Arylsulphonylamino carboxylic acid | | CAS: | 78521-39-8 | | MF: | C13H19NO4S | | MW: | 285.36 | | EINECS: | 278-934-5 | | Product Categories: | | | Mol File: | 78521-39-8.mol | ![6-[[(4-methylphenyl)sulphonyl]amino]hexanoic acid Structure](CAS/GIF/78521-39-8.gif) |
| | 6-[[(4-methylphenyl)sulphonyl]amino]hexanoic acid Chemical Properties |
| Melting point | 106-108 °C | | Boiling point | 475.2±55.0 °C(Predicted) | | density | 1.175[at 20℃] | | vapor pressure | 0Pa at 20℃ | | storage temp. | 2-8°C | | pka | 4.44[at 20 ℃] | | Water Solubility | 317mg/L at 25℃ | | InChI | InChI=1S/C13H19NO4S/c1-11-6-8-12(9-7-11)19(17,18)14-10-4-2-3-5-13(15)16/h6-9,14H,2-5,10H2,1H3,(H,15,16) | | InChIKey | GLKZGJGPYOFPKV-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCNS(C1=CC=C(C)C=C1)(=O)=O | | LogP | 1.96 at 20℃ | | EPA Substance Registry System | Hexanoic acid, 6-[[(4-methylphenyl)sulfonyl]amino]- (78521-39-8) |
| | 6-[[(4-methylphenyl)sulphonyl]amino]hexanoic acid Usage And Synthesis |
| Application | It is used in metalworking fluids, industrial cleaning agents, water-based hydraulic fluids, water treatment processes, lubricants for offshore oil/gas drilling, engine antifreeze (coolant), water-based quenching fluids, water-glycol fire-resistant hydraulic fluid (HFC), and leveling fluids. | | Flammability and Explosibility | Non flammable |
| | 6-[[(4-methylphenyl)sulphonyl]amino]hexanoic acid Preparation Products And Raw materials |
|