- Doxepin EP Impurity B
-
- $0.00 / 100mg
-
2025-12-16
- CAS:4504-88-5
- Min. Order: 10mg
- Purity: 95
- Supply Ability: 100000
|
| | 11-[3-(dimethylamino)propyl]-6,11-dihydrodibenz[b,e]oxepin-11-ol Basic information |
| Product Name: | 11-[3-(dimethylamino)propyl]-6,11-dihydrodibenz[b,e]oxepin-11-ol | | Synonyms: | 11-[3-(dimethylamino)propyl]-6,11-dihydrodibenz[b,e]oxepin-11-ol;Doxepinol;Doxepin Related Compound B (50 mg) ((11RS)-11-[3-(dimethylamino)propyl]-6,11-dihydrodibenzo[b,e]oxepin-11-ol);11-[3-(dimethylamino)propyl]-6H-benzo[c][1]benzoxepin-11-ol;Doxepin Hydrochloride impurity B;Doxepin EP Impurity B;Doxepin Impurity 2(Doxepin EP Impurity B);11-[3-(DiMethylaMino)propyl]-6,11-dihydrocibenz[b,e]oxepin-11-ol | | CAS: | 4504-88-5 | | MF: | C19H23NO2 | | MW: | 297.39 | | EINECS: | 224-821-0 | | Product Categories: | | | Mol File: | 4504-88-5.mol | ![11-[3-(dimethylamino)propyl]-6,11-dihydrodibenz[b,e]oxepin-11-ol Structure](CAS/GIF/4504-88-5.gif) |
| | 11-[3-(dimethylamino)propyl]-6,11-dihydrodibenz[b,e]oxepin-11-ol Chemical Properties |
| Melting point | 114 - 118°C | | Boiling point | 439.2±45.0 °C(Predicted) | | density | 1.123±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Acetonitrile (Slightly), Chloroform (Slightly) | | form | Solid | | pka | 13.58±0.20(Predicted) | | color | White to Pale Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C19H23NO2/c1-20(2)13-7-12-19(21)16-9-4-3-8-15(16)14-22-18-11-6-5-10-17(18)19/h3-6,8-11,21H,7,12-14H2,1-2H3 | | InChIKey | ZEKLFUWSVQYTOO-UHFFFAOYSA-N | | SMILES | N(CCCC1(c2c(cccc2)OCc3c1cccc3)O)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2932996560 | | Storage Class | 11 - Combustible Solids |
| | 11-[3-(dimethylamino)propyl]-6,11-dihydrodibenz[b,e]oxepin-11-ol Usage And Synthesis |
| Uses | 11-[3-(Dimethylamino)propyl]-6,11-dihydrocibenz[b,e]oxepin-11-ol is an impurity in the synthesis of Doxepin (D550000), used clinically to treat anxiety and depression. Doxepin is an antidepressant. |
| | 11-[3-(dimethylamino)propyl]-6,11-dihydrodibenz[b,e]oxepin-11-ol Preparation Products And Raw materials |
|