| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 3-phenylpropyl salicylate Basic information |
| Product Name: | 3-phenylpropyl salicylate | | Synonyms: | 3-phenylpropyl salicylate;Benzoic acid, 2-hydroxy-, 3-phenylpropyl ester;3-Phenylpropyl=2-hydroxybenzoate;Salicylic acid 3-phenylpropyl ester;Brn 2120148;Einecs 246-458-7;Propanol, 3-phenyl-, salicylate | | CAS: | 24781-13-3 | | MF: | C16H16O3 | | MW: | 256.3 | | EINECS: | 246-458-7 | | Product Categories: | | | Mol File: | 24781-13-3.mol |  |
| | 3-phenylpropyl salicylate Chemical Properties |
| Boiling point | 359.54°C (rough estimate) | | density | 1.1320 (rough estimate) | | refractive index | 1.5400 (estimate) | | form | solid | | InChI | 1S/C16H16O3/c17-15-11-5-4-10-14(15)16(18)19-12-6-9-13-7-2-1-3-8-13/h1-5,7-8,10-11,17H,6,9,12H2 | | InChIKey | GMHNYYKDPGWAJR-UHFFFAOYSA-N | | SMILES | O=C(OCCCC1=CC=CC=C1)C(C=CC=C2)=C2O | | LogP | 4.840 | | EPA Substance Registry System | Benzoic acid, 2-hydroxy-, 3-phenylpropyl ester (24781-13-3) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 3-phenylpropyl salicylate Usage And Synthesis |
| | 3-phenylpropyl salicylate Preparation Products And Raw materials |
|