| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Lead hydrogen phosphate
CAS:15845-52-0
Purity:98% Package:50G Remarks:663328-50G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Lead hydrogen phosphate 98%
CAS:15845-52-0
Purity:98% Package:1ea;50g Remarks:NULL
|
|
| | lead hydrogenorthophosphate Basic information |
| | lead hydrogenorthophosphate Chemical Properties |
| density | 5.66 g/mL at 25 °C | | form | white monoclinic crystals | | color | white monoclinic crystals, crystalline | | InChI | 1S/H3O4P.Pb/c1-5(2,3)4;/h(H3,1,2,3,4);/q;+2/p-2 | | InChIKey | AVVSGTOJTRSKRL-UHFFFAOYSA-L | | SMILES | [PbH2++].OP([O-])([O-])=O | | EPA Substance Registry System | Phosphoric acid, lead(2+) salt (1:1) (15845-52-0) |
| Hazard Codes | T,N | | Risk Statements | 61-20/22-33-50/53-62 | | Safety Statements | 53-45-60-61 | | RIDADR | 3288 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Repr. 1A
STOT RE 2 |
| | lead hydrogenorthophosphate Usage And Synthesis |
| | lead hydrogenorthophosphate Preparation Products And Raw materials |
|