2-Chloro-2',4'-dihydroxyacetophenone manufacturers
|
| | 2-Chloro-2',4'-dihydroxyacetophenone Basic information |
| Product Name: | 2-Chloro-2',4'-dihydroxyacetophenone | | Synonyms: | 2,4-Dihydroxyphenacyl chloride;2-Chloro-1-(2,4-dihydroxyphenyl)ethanone;Ethanone, 2-chloro-1-(2,4-dihydroxyphenyl)-;2-Chloro-2',4'-dihydroxyacetophenone, 2-Chloro-1-(2,4-dihydroxyphenyl)ethan-1-one;2-chloro-2-4-dihydroxyacetophenone;Isoproterenol Impurity 4;Adrenaline Impurity 8;2-chloro-1-(2,4-dihydroxyphenyl)ethanon | | CAS: | 25015-92-3 | | MF: | C8H7ClO3 | | MW: | 186.59 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 25015-92-3.mol |  |
| | 2-Chloro-2',4'-dihydroxyacetophenone Chemical Properties |
| Melting point | 130-132 ºC | | Boiling point | 366.4±11.0 °C(Predicted) | | density | 1.444 | | pka | 7.31±0.35(Predicted) | | InChI | InChI=1S/C8H7ClO3/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,10-11H,4H2 | | InChIKey | PKYLMJSVVVYYRS-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(O)C=C1O)CCl |
| | 2-Chloro-2',4'-dihydroxyacetophenone Usage And Synthesis |
| | 2-Chloro-2',4'-dihydroxyacetophenone Preparation Products And Raw materials |
|