|
|
| | 4-N-Boc-2-cyanopiperidine Basic information |
| Product Name: | 4-N-Boc-2-cyanopiperidine | | Synonyms: | 4-Boc-2-cyanopiperidine;4-N-Boc-2-cyanopiperazine;1-Piperazinecarboxylic acid, 3-cyano-, 1,1-diMethylethyl ester;1-Boc-3-cyanopiperazine;3-Cyano-1-piperazinecarboxylic acid 1,1-dimethylethyl ester;4-N-Boc-2-cyanopiperidine;tert-Butyl-2-cyanpiperidin-4-carboxylat;2-cyano-4-piperidinecarboxylic acid tert-butyl ester | | CAS: | 859518-35-7 | | MF: | C10H17N3O2 | | MW: | 211.26 | | EINECS: | | | Product Categories: | | | Mol File: | 859518-35-7.mol |  |
| | 4-N-Boc-2-cyanopiperidine Chemical Properties |
| Boiling point | 343℃ | | density | 1.12 | | Fp | 161℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 4.88±0.40(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C10H17N3O2/c1-10(2,3)15-9(14)13-5-4-12-8(6-11)7-13/h8,12H,4-5,7H2,1-3H3 | | InChIKey | CBFXRUGJRMBDFG-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNC(C#N)C1 |
| | 4-N-Boc-2-cyanopiperidine Usage And Synthesis |
| | 4-N-Boc-2-cyanopiperidine Preparation Products And Raw materials |
|