|
|
| | 5,5''-dibromo-[2,2':5',2"]terthiohene Basic information |
| Product Name: | 5,5''-dibromo-[2,2':5',2"]terthiohene | | Synonyms: | 2,5-Bis(5-bromothiophen-2-yl)thiophene;5,5μμ-Dibromo-2,2μ:5μ,2μμ-terthiophene;2,5-Bis(5-broMo-2-thienyl)thiophene;5,5''-Dibromo-alpha-terthienyl;5,5''-Dibromo-2,2':5',2''-terthiophene 97%;5',2"]terthiohene;5,5''-dibromo-[2,2';5',2"]ter | | CAS: | 98057-08-0 | | MF: | C12H6Br2S3 | | MW: | 406.18 | | EINECS: | | | Product Categories: | Building Blocks;Chemical Synthesis;Halogenated Heterocycles;Heterocyclic Building Blocks;Materials Science;Organic and Printed Electronics;Synthetic Tools and Reagents;Thiophene Monomers and Building Blocks;Thiophenes | | Mol File: | 98057-08-0.mol |  |
| | 5,5''-dibromo-[2,2':5',2"]terthiohene Chemical Properties |
| Melting point | 150-155 °C | | Boiling point | 417.2±40.0 °C(Predicted) | | density | 1.839 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | color | Light yellow to Amber to Dark green | | InChI | InChI=1S/C12H6Br2S3/c13-11-5-3-9(16-11)7-1-2-8(15-7)10-4-6-12(14)17-10/h1-6H | | InChIKey | KXFPYYJGYVYXIB-UHFFFAOYSA-N | | SMILES | C1(C2SC(C3SC(Br)=CC=3)=CC=2)SC(Br)=CC=1 |
| Hazard Codes | T | | Risk Statements | 25-37/38-41 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 5,5''-dibromo-[2,2':5',2"]terthiohene Usage And Synthesis |
| | 5,5''-dibromo-[2,2':5',2"]terthiohene Preparation Products And Raw materials |
|