| Company Name: |
SAKEM LLP
|
| Tel: |
+91-9676889998 +91-9676889998 |
| Email: |
info@sakem.co.in |
| Products Intro: |
Product Name:4-Bromo Phenyl Methane Sulphonamide
CAS:4284-50-8
Purity:98% Package:5 kg, 25 kg, 100 kg and 1 MT
|
|
| | N-(4-BROMOPHENYL)METHANESULFONAMIDE, 97% Basic information |
| Product Name: | N-(4-BROMOPHENYL)METHANESULFONAMIDE, 97% | | Synonyms: | N-(4-BROMOPHENYL)METHANESULFONAMIDE, 97%;N-(4-Bromophenyl)methansulfonamide;4-(Methylsulfonylamido)bromobenzene;Methansulfonic acid-(4-bromoanilide);4'-BroMoMethanesulfonanilide;Methanesulfonanilide, 4'-broMo- (6CI,7CI,8CI);N-(4-BroMophenyl)MethanesulfonaMide 97%;N-(4-BROMOPHENYL)METHANESULFONAMIDE-2 | | CAS: | 4284-50-8 | | MF: | C7H8BrNO2S | | MW: | 250.11 | | EINECS: | | | Product Categories: | Organoborons;Aryl;Organohalides | | Mol File: | 4284-50-8.mol |  |
| | N-(4-BROMOPHENYL)METHANESULFONAMIDE, 97% Chemical Properties |
| Melting point | 137-141 °C | | Boiling point | 333.0±44.0 °C(Predicted) | | density | 1.711±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 7.62±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H8BrNO2S/c1-12(10,11)9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 | | InChIKey | KKOIRAFXKFYZHQ-UHFFFAOYSA-N | | SMILES | CS(NC1=CC=C(Br)C=C1)(=O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N-(4-BROMOPHENYL)METHANESULFONAMIDE, 97% Usage And Synthesis |
| | N-(4-BROMOPHENYL)METHANESULFONAMIDE, 97% Preparation Products And Raw materials |
|