|
|
| | 6-Hydroxy-chroman-4-one Basic information |
| Product Name: | 6-Hydroxy-chroman-4-one | | Synonyms: | 6-hydroxy-2,3-dihydrochroMen-4-one;4H-1-Benzopyran-4-one, 2,3-dihydro-6-hydroxy-;6-Hydroxy-4-chromanone;6-HYDROXY-CHROMAN-4-ONE | | CAS: | 80096-64-6 | | MF: | C9H8O3 | | MW: | 164.16 | | EINECS: | | | Product Categories: | | | Mol File: | 80096-64-6.mol |  |
| | 6-Hydroxy-chroman-4-one Chemical Properties |
| Melting point | 129-131 °C(Solv: benzene (71-43-2); ligroine (8032-32-4)) | | Boiling point | 372.4±42.0 °C(Predicted) | | density | 1.343±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 9.58±0.20(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C9H8O3/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5,10H,3-4H2 | | InChIKey | HTKPIKIGEYFNBY-UHFFFAOYSA-N | | SMILES | C1OC2=CC=C(O)C=C2C(=O)C1 |
| | 6-Hydroxy-chroman-4-one Usage And Synthesis |
| Uses | 6-Hydroxy-chroman-4-one is used in the preparation of novels parasite transmission blocking antimalarials targeting male gametes | | Synthesis | (3) Preparation of 2,3-dihydro-6-hydroxychromen-4-one: 6-methoxychromen-dihydropyran-4-one (2.9 g, 0.0163 mol) was sequentially added to a mixed solution of glacial acetic acid (20 mL) and HBr (>40%, 20 mL), stirred and refluxed for 1 h. The reaction solution was then extracted with ethyl acetate. Upon completion of the reaction, the pH of the reaction solution was adjusted to 10-11 with KOH solution, and then the pH of the aqueous layer was adjusted to 2-3 with concentrated hydrochloric acid.Subsequently, the aqueous layer was extracted with ethyl acetate, and the organic layers were combined and dried with anhydrous Na2SO4. The dried organic layer was cooled and a black solid was precipitated. The solid was recrystallized with ethyl acetate to give 2.17 g of bright yellow crystals with a melting point of 142-144 °C and a yield of 81.2%. | | References | [1] Bioorganic and Medicinal Chemistry Letters, 1999, vol. 9, # 18, p. 2773 - 2778
[2] Patent: US5641789, 1997, A
[3] Patent: US2008/103307, 2008, A1. Location in patent: Page/Page column 17
[4] Patent: US5322847, 1994, A
[5] Patent: EP641792, 1995, A1 |
| | 6-Hydroxy-chroman-4-one Preparation Products And Raw materials |
|